C9H9ClN4O2S — CID 22151116
2-chloro-6-(1,2,4-triazol-1-ylmethyl)benzenesulfonamide (PubChem CID 22151116) has the molecular formula C9H9ClN4O2S and a molecular weight of 272.72 g/mol. Its IUPAC name is 2-chloro-6-(1,2,4-triazol-1-ylmethyl)benzenesulfonamide.
| Compound Name | 2-chloro-6-(1,2,4-triazol-1-ylmethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 22151116 |
| Molecular Formula | C9H9ClN4O2S |
| Molecular Weight | 272.72 g/mol |
| Exact Mass | 272.01 |
| IUPAC Name | 2-chloro-6-(1,2,4-triazol-1-ylmethyl)benzenesulfonamide |
| SMILES | NS(=O)(=O)c1c(Cl)cccc1Cn1cncn1 |
| InChI | InChI=1S/C9H9ClN4O2S/c10-8-3-1-2-7(9(8)17(11,15)16)4-14-6-12-5-13-14/h1-3,5-6H,4H2,(H2,11,15,16) |
| InChIKey | PGFIHXSNFYWMTP-UHFFFAOYSA-N |
| XLogP | 0.63 |
| TPSA | 90.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.72 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |