About 2-chloro-6-(1,2,4-triazol-1-ylmethyl)benzenesulfonamide
2-chloro-6-(1,2,4-triazol-1-ylmethyl)benzenesulfonamide (PubChem CID 22151116) has the molecular formula C9H9ClN4O2S
and a molecular weight of 272.72 g/mol. Its IUPAC name is 2-chloro-6-(1,2,4-triazol-1-ylmethyl)benzenesulfonamide.
Molecular Properties
| Compound Name | 2-chloro-6-(1,2,4-triazol-1-ylmethyl)benzenesulfonamide |
| PubChem CID | 22151116 |
| Molecular Formula | C9H9ClN4O2S |
| Molecular Weight | 272.72 g/mol |
| Exact Mass | 272.01 |
| IUPAC Name | 2-chloro-6-(1,2,4-triazol-1-ylmethyl)benzenesulfonamide |
| SMILES | NS(=O)(=O)c1c(Cl)cccc1Cn1cncn1 |
| InChI | InChI=1S/C9H9ClN4O2S/c10-8-3-1-2-7(9(8)17(11,15)16)4-14-6-12-5-13-14/h1-3,5-6H,4H2,(H2,11,15,16) |
| InChIKey | PGFIHXSNFYWMTP-UHFFFAOYSA-N |
| XLogP | 0.63 |
| TPSA | 90.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 272.72 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-chloro-6-(1,2,4-triazol-1-ylmethyl)benzenesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-chloro-6-(1,2,4-triazol-1-ylmethyl)benzenesulfonamide?
The IUPAC name of 2-chloro-6-(1,2,4-triazol-1-ylmethyl)benzenesulfonamide (CID 22151116) is 2-chloro-6-(1,2,4-triazol-1-ylmethyl)benzenesulfonamide.
What is the SMILES notation for 2-chloro-6-(1,2,4-triazol-1-ylmethyl)benzenesulfonamide?
The canonical SMILES for 2-chloro-6-(1,2,4-triazol-1-ylmethyl)benzenesulfonamide is NS(=O)(=O)c1c(Cl)cccc1Cn1cncn1.
What is the InChIKey of 2-chloro-6-(1,2,4-triazol-1-ylmethyl)benzenesulfonamide?
The InChIKey is PGFIHXSNFYWMTP-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H9ClN4O2S/c10-8-3-1-2-7(9(8)17(11,15)16)4-14-6-12-5-13-14/h1-3,5-6H,4H2,(H2,11,15,16).
What are the key properties of 2-chloro-6-(1,2,4-triazol-1-ylmethyl)benzenesulfonamide?
2-chloro-6-(1,2,4-triazol-1-ylmethyl)benzenesulfonamide has a molecular weight of 272.72 g/mol, XLogP of 0.63, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-chloro-6-(1,2,4-triazol-1-ylmethyl)benzenesulfonamide is sourced from PubChem (CID 22151116), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).