C11H14Cl2N4 — CID 115595731
N-[(2-chlorophenyl)methyl]-2-(1,2,4-triazol-1-yl)ethanamine;hydrochloride (PubChem CID 115595731) has the molecular formula C11H14Cl2N4 and a molecular weight of 273.17 g/mol. Its IUPAC name is N-[(2-chlorophenyl)methyl]-2-(1,2,4-triazol-1-yl)ethanamine;hydrochloride.
| Compound Name | N-[(2-chlorophenyl)methyl]-2-(1,2,4-triazol-1-yl)ethanamine;hydrochloride |
|---|---|
| PubChem CID | 115595731 |
| Molecular Formula | C11H14Cl2N4 |
| Molecular Weight | 273.17 g/mol |
| Exact Mass | 272.06 |
| IUPAC Name | N-[(2-chlorophenyl)methyl]-2-(1,2,4-triazol-1-yl)ethanamine;hydrochloride |
| SMILES | Cl.Clc1ccccc1CNCCn1cncn1 |
| InChI | InChI=1S/C11H13ClN4.ClH/c12-11-4-2-1-3-10(11)7-13-5-6-16-9-14-8-15-16;/h1-4,8-9,13H,5-7H2;1H |
| InChIKey | CTLUGTPHEXCXFY-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 42.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.17 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|