C11H13N3 — CID 173307383
1-[2-(2-methylphenyl)ethyl]-1,2,4-triazole (PubChem CID 173307383) has the molecular formula C11H13N3 and a molecular weight of 187.25 g/mol. Its IUPAC name is 1-[2-(2-methylphenyl)ethyl]-1,2,4-triazole.
| Compound Name | 1-[2-(2-methylphenyl)ethyl]-1,2,4-triazole |
|---|---|
| PubChem CID | 173307383 |
| Molecular Formula | C11H13N3 |
| Molecular Weight | 187.25 g/mol |
| Exact Mass | 187.11 |
| IUPAC Name | 1-[2-(2-methylphenyl)ethyl]-1,2,4-triazole |
| SMILES | Cc1ccccc1CCn1cncn1 |
| InChI | InChI=1S/C11H13N3/c1-10-4-2-3-5-11(10)6-7-14-9-12-8-13-14/h2-5,8-9H,6-7H2,1H3 |
| InChIKey | MYNPZRQICXFUBN-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 187.25 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |