C11H11N7 — CID 102265098
2,6-bis(1,2,4-triazol-1-ylmethyl)pyridine (PubChem CID 102265098) has the molecular formula C11H11N7 and a molecular weight of 241.26 g/mol. Its IUPAC name is 2,6-bis(1,2,4-triazol-1-ylmethyl)pyridine.
| Compound Name | 2,6-bis(1,2,4-triazol-1-ylmethyl)pyridine |
|---|---|
| PubChem CID | 102265098 |
| Molecular Formula | C11H11N7 |
| Molecular Weight | 241.26 g/mol |
| Exact Mass | 241.11 |
| IUPAC Name | 2,6-bis(1,2,4-triazol-1-ylmethyl)pyridine |
| SMILES | c1cc(Cn2cncn2)nc(Cn2cncn2)c1 |
| InChI | InChI=1S/C11H11N7/c1-2-10(4-17-8-12-6-14-17)16-11(3-1)5-18-9-13-7-15-18/h1-3,6-9H,4-5H2 |
| InChIKey | USMZVVREKFYNJI-UHFFFAOYSA-N |
| XLogP | 0.36 |
| TPSA | 74.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.26 |
| LogP ≤ 5 | 0.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |