About [3-(1,2,4-triazol-1-ylmethyl)-2-pyridinyl]methanamine
[3-(1,2,4-triazol-1-ylmethyl)-2-pyridinyl]methanamine (PubChem CID 62894674) has the molecular formula C9H11N5
and a molecular weight of 189.22 g/mol. Its IUPAC name is [3-(1,2,4-triazol-1-ylmethyl)-2-pyridinyl]methanamine.
Analyze [3-(1,2,4-triazol-1-ylmethyl)-2-pyridinyl]methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3-(1,2,4-triazol-1-ylmethyl)-2-pyridinyl]methanamine?
The IUPAC name of [3-(1,2,4-triazol-1-ylmethyl)-2-pyridinyl]methanamine (CID 62894674) is [3-(1,2,4-triazol-1-ylmethyl)-2-pyridinyl]methanamine.
What is the SMILES notation for [3-(1,2,4-triazol-1-ylmethyl)-2-pyridinyl]methanamine?
The canonical SMILES for [3-(1,2,4-triazol-1-ylmethyl)-2-pyridinyl]methanamine is NCc1ncccc1Cn1cncn1.
What is the InChIKey of [3-(1,2,4-triazol-1-ylmethyl)-2-pyridinyl]methanamine?
The InChIKey is JXKHIMAXQSPXSU-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H11N5/c10-4-9-8(2-1-3-12-9)5-14-7-11-6-13-14/h1-3,6-7H,4-5,10H2.
What are the key properties of [3-(1,2,4-triazol-1-ylmethyl)-2-pyridinyl]methanamine?
[3-(1,2,4-triazol-1-ylmethyl)-2-pyridinyl]methanamine has a molecular weight of 189.22 g/mol, XLogP of 0.18, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [3-(1,2,4-triazol-1-ylmethyl)-2-pyridinyl]methanamine is sourced from PubChem (CID 62894674), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).