C15H14ClN3O2 — CID 67101110
2-[[2-(aminomethyl)-3-pyridinyl]methyl]isoindole-1,3-dione;hydrochloride (PubChem CID 67101110) has the molecular formula C15H14ClN3O2 and a molecular weight of 303.75 g/mol. Its IUPAC name is 2-[[2-(aminomethyl)-3-pyridinyl]methyl]isoindole-1,3-dione;hydrochloride.
| Compound Name | 2-[[2-(aminomethyl)-3-pyridinyl]methyl]isoindole-1,3-dione;hydrochloride |
|---|---|
| PubChem CID | 67101110 |
| Molecular Formula | C15H14ClN3O2 |
| Molecular Weight | 303.75 g/mol |
| Exact Mass | 303.08 |
| IUPAC Name | 2-[[2-(aminomethyl)-3-pyridinyl]methyl]isoindole-1,3-dione;hydrochloride |
| SMILES | Cl.NCc1ncccc1CN1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C15H13N3O2.ClH/c16-8-13-10(4-3-7-17-13)9-18-14(19)11-5-1-2-6-12(11)15(18)20;/h1-7H,8-9,16H2;1H |
| InChIKey | DOHXPJDUIDJWPP-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 76.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.75 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|