C5H5N3O — CID 68765220
1-(oxiren-2-ylmethyl)-1,2,4-triazole (PubChem CID 68765220) has the molecular formula C5H5N3O and a molecular weight of 123.11 g/mol. Its IUPAC name is 1-(oxiren-2-ylmethyl)-1,2,4-triazole.
| Compound Name | 1-(oxiren-2-ylmethyl)-1,2,4-triazole |
|---|---|
| PubChem CID | 68765220 |
| Molecular Formula | C5H5N3O |
| Molecular Weight | 123.11 g/mol |
| Exact Mass | 123.04 |
| IUPAC Name | 1-(oxiren-2-ylmethyl)-1,2,4-triazole |
| SMILES | C1=C(Cn2cncn2)O1 |
| InChI | InChI=1S/C5H5N3O/c1(5-2-9-5)8-4-6-3-7-8/h2-4H,1H2 |
| InChIKey | NIEPYEZSCYPAOE-UHFFFAOYSA-N |
| XLogP | 0.15 |
| TPSA | 43.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 123.11 |
| LogP ≤ 5 | 0.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |