C14H20N2O2S — CID 107352739
2-(cyclopentylsulfanylmethyl)-N-ethyl-6-nitroaniline (PubChem CID 107352739) has the molecular formula C14H20N2O2S and a molecular weight of 280.39 g/mol. Its IUPAC name is 2-(cyclopentylsulfanylmethyl)-N-ethyl-6-nitroaniline.
| Compound Name | 2-(cyclopentylsulfanylmethyl)-N-ethyl-6-nitroaniline |
|---|---|
| PubChem CID | 107352739 |
| Molecular Formula | C14H20N2O2S |
| Molecular Weight | 280.39 g/mol |
| Exact Mass | 280.12 |
| IUPAC Name | 2-(cyclopentylsulfanylmethyl)-N-ethyl-6-nitroaniline |
| SMILES | CCNc1c(CSC2CCCC2)cccc1[N+](=O)[O-] |
| InChI | InChI=1S/C14H20N2O2S/c1-2-15-14-11(6-5-9-13(14)16(17)18)10-19-12-7-3-4-8-12/h5-6,9,12,15H,2-4,7-8,10H2,1H3 |
| InChIKey | CAGWGQUCGNIZPA-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 55.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.39 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|