C15H25N3O2 — CID 107351125
2-[[2,2-dimethylpropyl(methyl)amino]methyl]-N-ethyl-6-nitroaniline (PubChem CID 107351125) has the molecular formula C15H25N3O2 and a molecular weight of 279.38 g/mol. Its IUPAC name is 2-[[2,2-dimethylpropyl(methyl)amino]methyl]-N-ethyl-6-nitroaniline.
| Compound Name | 2-[[2,2-dimethylpropyl(methyl)amino]methyl]-N-ethyl-6-nitroaniline |
|---|---|
| PubChem CID | 107351125 |
| Molecular Formula | C15H25N3O2 |
| Molecular Weight | 279.38 g/mol |
| Exact Mass | 279.19 |
| IUPAC Name | 2-[[2,2-dimethylpropyl(methyl)amino]methyl]-N-ethyl-6-nitroaniline |
| SMILES | CCNc1c(CN(C)CC(C)(C)C)cccc1[N+](=O)[O-] |
| InChI | InChI=1S/C15H25N3O2/c1-6-16-14-12(8-7-9-13(14)18(19)20)10-17(5)11-15(2,3)4/h7-9,16H,6,10-11H2,1-5H3 |
| InChIKey | FKHKXGQKDJKWGD-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 58.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.38 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|