C10H13F3N4O2 — CID 107352881
2,2,2-trifluoro-N-[(2-hydrazinyl-3-nitrophenyl)methyl]-N-methylethanamine (PubChem CID 107352881) has the molecular formula C10H13F3N4O2 and a molecular weight of 278.23 g/mol. Its IUPAC name is 2,2,2-trifluoro-N-[(2-hydrazinyl-3-nitrophenyl)methyl]-N-methylethanamine.
| Compound Name | 2,2,2-trifluoro-N-[(2-hydrazinyl-3-nitrophenyl)methyl]-N-methylethanamine |
|---|---|
| PubChem CID | 107352881 |
| Molecular Formula | C10H13F3N4O2 |
| Molecular Weight | 278.23 g/mol |
| Exact Mass | 278.10 |
| IUPAC Name | 2,2,2-trifluoro-N-[(2-hydrazinyl-3-nitrophenyl)methyl]-N-methylethanamine |
| SMILES | CN(Cc1cccc([N+](=O)[O-])c1NN)CC(F)(F)F |
| InChI | InChI=1S/C10H13F3N4O2/c1-16(6-10(11,12)13)5-7-3-2-4-8(17(18)19)9(7)15-14/h2-4,15H,5-6,14H2,1H3 |
| InChIKey | STYQSLVQSQHDIO-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 84.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.23 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|