C13H19FN2O2 — CID 107348267
N-[(2-fluoro-3-nitrophenyl)methyl]-N,2,2-trimethylpropan-1-amine (PubChem CID 107348267) has the molecular formula C13H19FN2O2 and a molecular weight of 254.30 g/mol. Its IUPAC name is N-[(2-fluoro-3-nitrophenyl)methyl]-N,2,2-trimethylpropan-1-amine.
| Compound Name | N-[(2-fluoro-3-nitrophenyl)methyl]-N,2,2-trimethylpropan-1-amine |
|---|---|
| PubChem CID | 107348267 |
| Molecular Formula | C13H19FN2O2 |
| Molecular Weight | 254.30 g/mol |
| Exact Mass | 254.14 |
| IUPAC Name | N-[(2-fluoro-3-nitrophenyl)methyl]-N,2,2-trimethylpropan-1-amine |
| SMILES | CN(Cc1cccc([N+](=O)[O-])c1F)CC(C)(C)C |
| InChI | InChI=1S/C13H19FN2O2/c1-13(2,3)9-15(4)8-10-6-5-7-11(12(10)14)16(17)18/h5-7H,8-9H2,1-4H3 |
| InChIKey | DUTGIPNKOSHCJE-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 46.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.30 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|