C9H10BrN3S — CID 107353952
N-[1-(4-bromothiophen-2-yl)ethyl]-1H-pyrazol-4-amine (PubChem CID 107353952) has the molecular formula C9H10BrN3S and a molecular weight of 272.17 g/mol. Its IUPAC name is N-[1-(4-bromothiophen-2-yl)ethyl]-1H-pyrazol-4-amine.
| Compound Name | N-[1-(4-bromothiophen-2-yl)ethyl]-1H-pyrazol-4-amine |
|---|---|
| PubChem CID | 107353952 |
| Molecular Formula | C9H10BrN3S |
| Molecular Weight | 272.17 g/mol |
| Exact Mass | 270.98 |
| IUPAC Name | N-[1-(4-bromothiophen-2-yl)ethyl]-1H-pyrazol-4-amine |
| SMILES | CC(Nc1cn[nH]c1)c1cc(Br)cs1 |
| InChI | InChI=1S/C9H10BrN3S/c1-6(9-2-7(10)5-14-9)13-8-3-11-12-4-8/h2-6,13H,1H3,(H,11,12) |
| InChIKey | UMJZJLOXUALTQR-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 40.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.17 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |