C10H12BrN3S — CID 107355493
N-[[5-(4-bromothiophen-2-yl)-1H-pyrazol-4-yl]methyl]ethanamine (PubChem CID 107355493) has the molecular formula C10H12BrN3S and a molecular weight of 286.20 g/mol. Its IUPAC name is N-[[5-(4-bromothiophen-2-yl)-1H-pyrazol-4-yl]methyl]ethanamine.
| Compound Name | N-[[5-(4-bromothiophen-2-yl)-1H-pyrazol-4-yl]methyl]ethanamine |
|---|---|
| PubChem CID | 107355493 |
| Molecular Formula | C10H12BrN3S |
| Molecular Weight | 286.20 g/mol |
| Exact Mass | 284.99 |
| IUPAC Name | N-[[5-(4-bromothiophen-2-yl)-1H-pyrazol-4-yl]methyl]ethanamine |
| SMILES | CCNCc1cn[nH]c1-c1cc(Br)cs1 |
| InChI | InChI=1S/C10H12BrN3S/c1-2-12-4-7-5-13-14-10(7)9-3-8(11)6-15-9/h3,5-6,12H,2,4H2,1H3,(H,13,14) |
| InChIKey | PSVXNUMLPRUMIS-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 40.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.20 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |