C10H6BrN3S — CID 107355573
2-(4-bromothiophen-2-yl)imidazo[1,2-a]pyrimidine (PubChem CID 107355573) has the molecular formula C10H6BrN3S and a molecular weight of 280.15 g/mol. Its IUPAC name is 2-(4-bromothiophen-2-yl)imidazo[1,2-a]pyrimidine.
| Compound Name | 2-(4-bromothiophen-2-yl)imidazo[1,2-a]pyrimidine |
|---|---|
| PubChem CID | 107355573 |
| Molecular Formula | C10H6BrN3S |
| Molecular Weight | 280.15 g/mol |
| Exact Mass | 278.95 |
| IUPAC Name | 2-(4-bromothiophen-2-yl)imidazo[1,2-a]pyrimidine |
| SMILES | Brc1csc(-c2cn3cccnc3n2)c1 |
| InChI | InChI=1S/C10H6BrN3S/c11-7-4-9(15-6-7)8-5-14-3-1-2-12-10(14)13-8/h1-6H |
| InChIKey | MVTROPFSIHDYEI-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 30.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.15 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |