C24H19N3O2 — CID 1073560
(E)-3-(1-benzylindol-3-yl)-2-cyano-N-(furan-2-ylmethyl)prop-2-enamide (PubChem CID 1073560) has the molecular formula C24H19N3O2 and a molecular weight of 381.44 g/mol. Its IUPAC name is (E)-3-(1-benzylindol-3-yl)-2-cyano-N-(furan-2-ylmethyl)prop-2-enamide.
| Compound Name | (E)-3-(1-benzylindol-3-yl)-2-cyano-N-(furan-2-ylmethyl)prop-2-enamide |
|---|---|
| PubChem CID | 1073560 |
| Molecular Formula | C24H19N3O2 |
| Molecular Weight | 381.44 g/mol |
| Exact Mass | 381.15 |
| IUPAC Name | (E)-3-(1-benzylindol-3-yl)-2-cyano-N-(furan-2-ylmethyl)prop-2-enamide |
| SMILES | N#C/C(=C\c1cn(Cc2ccccc2)c2ccccc12)C(=O)NCc1ccco1 |
| InChI | InChI=1S/C24H19N3O2/c25-14-19(24(28)26-15-21-9-6-12-29-21)13-20-17-27(16-18-7-2-1-3-8-18)23-11-5-4-10-22(20)23/h1-13,17H,15-16H2,(H,26,28)/b19-13+ |
| InChIKey | MBWFUYNQIJHPJS-CPNJWEJPSA-N |
| XLogP | 4.51 |
| TPSA | 70.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.44 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|