C17H25N3O — CID 107356260
N-(3-ethylcyclohexyl)-1,2,3,4-tetrahydroquinoxaline-2-carboxamide (PubChem CID 107356260) has the molecular formula C17H25N3O and a molecular weight of 287.41 g/mol. Its IUPAC name is N-(3-ethylcyclohexyl)-1,2,3,4-tetrahydroquinoxaline-2-carboxamide.
| Compound Name | N-(3-ethylcyclohexyl)-1,2,3,4-tetrahydroquinoxaline-2-carboxamide |
|---|---|
| PubChem CID | 107356260 |
| Molecular Formula | C17H25N3O |
| Molecular Weight | 287.41 g/mol |
| Exact Mass | 287.20 |
| IUPAC Name | N-(3-ethylcyclohexyl)-1,2,3,4-tetrahydroquinoxaline-2-carboxamide |
| SMILES | CCC1CCCC(NC(=O)C2CNc3ccccc3N2)C1 |
| InChI | InChI=1S/C17H25N3O/c1-2-12-6-5-7-13(10-12)19-17(21)16-11-18-14-8-3-4-9-15(14)20-16/h3-4,8-9,12-13,16,18,20H,2,5-7,10-11H2,1H3,(H,19,21) |
| InChIKey | WJSMKCHYQLVQDZ-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 53.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.41 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_NH_alk_C(2)', 'substructure': 'N/A'} |
|---|