C17H25N3O — CID 107356068
N-(cyclohexylmethyl)-N-methyl-1,2,3,4-tetrahydroquinoxaline-2-carboxamide (PubChem CID 107356068) has the molecular formula C17H25N3O and a molecular weight of 287.41 g/mol. Its IUPAC name is N-(cyclohexylmethyl)-N-methyl-1,2,3,4-tetrahydroquinoxaline-2-carboxamide.
| Compound Name | N-(cyclohexylmethyl)-N-methyl-1,2,3,4-tetrahydroquinoxaline-2-carboxamide |
|---|---|
| PubChem CID | 107356068 |
| Molecular Formula | C17H25N3O |
| Molecular Weight | 287.41 g/mol |
| Exact Mass | 287.20 |
| IUPAC Name | N-(cyclohexylmethyl)-N-methyl-1,2,3,4-tetrahydroquinoxaline-2-carboxamide |
| SMILES | CN(CC1CCCCC1)C(=O)C1CNc2ccccc2N1 |
| InChI | InChI=1S/C17H25N3O/c1-20(12-13-7-3-2-4-8-13)17(21)16-11-18-14-9-5-6-10-15(14)19-16/h5-6,9-10,13,16,18-19H,2-4,7-8,11-12H2,1H3 |
| InChIKey | IAKKTNWDKSFWDP-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.41 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_NH_alk_C(2)', 'substructure': 'N/A'} |
|---|