C17H27N3O — CID 107356117
N-butan-2-yl-N-butyl-1,2,3,4-tetrahydroquinoxaline-2-carboxamide (PubChem CID 107356117) has the molecular formula C17H27N3O and a molecular weight of 289.42 g/mol. Its IUPAC name is N-butan-2-yl-N-butyl-1,2,3,4-tetrahydroquinoxaline-2-carboxamide.
| Compound Name | N-butan-2-yl-N-butyl-1,2,3,4-tetrahydroquinoxaline-2-carboxamide |
|---|---|
| PubChem CID | 107356117 |
| Molecular Formula | C17H27N3O |
| Molecular Weight | 289.42 g/mol |
| Exact Mass | 289.22 |
| IUPAC Name | N-butan-2-yl-N-butyl-1,2,3,4-tetrahydroquinoxaline-2-carboxamide |
| SMILES | CCCCN(C(=O)C1CNc2ccccc2N1)C(C)CC |
| InChI | InChI=1S/C17H27N3O/c1-4-6-11-20(13(3)5-2)17(21)16-12-18-14-9-7-8-10-15(14)19-16/h7-10,13,16,18-19H,4-6,11-12H2,1-3H3 |
| InChIKey | HCTSPPJOVGAQHH-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.42 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_NH_alk_C(2)', 'substructure': 'N/A'} |
|---|