C16H25N3O2 — CID 107356101
N-(2-methoxyethyl)-N-(2-methylpropyl)-1,2,3,4-tetrahydroquinoxaline-2-carboxamide (PubChem CID 107356101) has the molecular formula C16H25N3O2 and a molecular weight of 291.39 g/mol. Its IUPAC name is N-(2-methoxyethyl)-N-(2-methylpropyl)-1,2,3,4-tetrahydroquinoxaline-2-carboxamide.
| Compound Name | N-(2-methoxyethyl)-N-(2-methylpropyl)-1,2,3,4-tetrahydroquinoxaline-2-carboxamide |
|---|---|
| PubChem CID | 107356101 |
| Molecular Formula | C16H25N3O2 |
| Molecular Weight | 291.39 g/mol |
| Exact Mass | 291.19 |
| IUPAC Name | N-(2-methoxyethyl)-N-(2-methylpropyl)-1,2,3,4-tetrahydroquinoxaline-2-carboxamide |
| SMILES | COCCN(CC(C)C)C(=O)C1CNc2ccccc2N1 |
| InChI | InChI=1S/C16H25N3O2/c1-12(2)11-19(8-9-21-3)16(20)15-10-17-13-6-4-5-7-14(13)18-15/h4-7,12,15,17-18H,8-11H2,1-3H3 |
| InChIKey | DHGRGMCJLIEGBZ-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.39 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_NH_alk_C(2)', 'substructure': 'N/A'} |
|---|