C14H19N3O3S — CID 107356032
N-(1,1-dioxothiolan-3-yl)-N-methyl-1,2,3,4-tetrahydroquinoxaline-2-carboxamide (PubChem CID 107356032) has the molecular formula C14H19N3O3S and a molecular weight of 309.39 g/mol. Its IUPAC name is N-(1,1-dioxothiolan-3-yl)-N-methyl-1,2,3,4-tetrahydroquinoxaline-2-carboxamide.
| Compound Name | N-(1,1-dioxothiolan-3-yl)-N-methyl-1,2,3,4-tetrahydroquinoxaline-2-carboxamide |
|---|---|
| PubChem CID | 107356032 |
| Molecular Formula | C14H19N3O3S |
| Molecular Weight | 309.39 g/mol |
| Exact Mass | 309.11 |
| IUPAC Name | N-(1,1-dioxothiolan-3-yl)-N-methyl-1,2,3,4-tetrahydroquinoxaline-2-carboxamide |
| SMILES | CN(C(=O)C1CNc2ccccc2N1)C1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C14H19N3O3S/c1-17(10-6-7-21(19,20)9-10)14(18)13-8-15-11-4-2-3-5-12(11)16-13/h2-5,10,13,15-16H,6-9H2,1H3 |
| InChIKey | DRCWKEHSLGKUQG-UHFFFAOYSA-N |
| XLogP | 0.54 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.39 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_NH_alk_C(2)', 'substructure': 'N/A'} |
|---|