C19H19NO4S — CID 9344377
N-[(3S)-1,1-dioxothiolan-3-yl]-N-methyl-9H-xanthene-9-carboxamide (PubChem CID 9344377) has the molecular formula C19H19NO4S and a molecular weight of 357.43 g/mol. Its IUPAC name is N-[(3S)-1,1-dioxothiolan-3-yl]-N-methyl-9H-xanthene-9-carboxamide.
| Compound Name | N-[(3S)-1,1-dioxothiolan-3-yl]-N-methyl-9H-xanthene-9-carboxamide |
|---|---|
| PubChem CID | 9344377 |
| Molecular Formula | C19H19NO4S |
| Molecular Weight | 357.43 g/mol |
| Exact Mass | 357.10 |
| IUPAC Name | N-[(3S)-1,1-dioxothiolan-3-yl]-N-methyl-9H-xanthene-9-carboxamide |
| SMILES | CN(C(=O)C1c2ccccc2Oc2ccccc21)[C@H]1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C19H19NO4S/c1-20(13-10-11-25(22,23)12-13)19(21)18-14-6-2-4-8-16(14)24-17-9-5-3-7-15(17)18/h2-9,13,18H,10-12H2,1H3/t13-/m0/s1 |
| InChIKey | KXZPKMNGFMEXJZ-ZDUSSCGKSA-N |
| XLogP | 2.57 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.43 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |