C16H16BrN3O — CID 107357164
N-[(3-bromofuran-2-yl)-quinoxalin-2-ylmethyl]propan-1-amine (PubChem CID 107357164) has the molecular formula C16H16BrN3O and a molecular weight of 346.23 g/mol. Its IUPAC name is N-[(3-bromofuran-2-yl)-quinoxalin-2-ylmethyl]propan-1-amine.
| Compound Name | N-[(3-bromofuran-2-yl)-quinoxalin-2-ylmethyl]propan-1-amine |
|---|---|
| PubChem CID | 107357164 |
| Molecular Formula | C16H16BrN3O |
| Molecular Weight | 346.23 g/mol |
| Exact Mass | 345.05 |
| IUPAC Name | N-[(3-bromofuran-2-yl)-quinoxalin-2-ylmethyl]propan-1-amine |
| SMILES | CCCNC(c1cnc2ccccc2n1)c1occc1Br |
| InChI | InChI=1S/C16H16BrN3O/c1-2-8-18-15(16-11(17)7-9-21-16)14-10-19-12-5-3-4-6-13(12)20-14/h3-7,9-10,15,18H,2,8H2,1H3 |
| InChIKey | VAFVAIQNSYYJIG-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 50.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.23 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |