C13H14BrClN2O — CID 103444901
N-[(3-bromofuran-2-yl)-(3-chloro-2-pyridinyl)methyl]propan-1-amine (PubChem CID 103444901) has the molecular formula C13H14BrClN2O and a molecular weight of 329.62 g/mol. Its IUPAC name is N-[(3-bromofuran-2-yl)-(3-chloro-2-pyridinyl)methyl]propan-1-amine.
| Compound Name | N-[(3-bromofuran-2-yl)-(3-chloro-2-pyridinyl)methyl]propan-1-amine |
|---|---|
| PubChem CID | 103444901 |
| Molecular Formula | C13H14BrClN2O |
| Molecular Weight | 329.62 g/mol |
| Exact Mass | 328.00 |
| IUPAC Name | N-[(3-bromofuran-2-yl)-(3-chloro-2-pyridinyl)methyl]propan-1-amine |
| SMILES | CCCNC(c1ncccc1Cl)c1occc1Br |
| InChI | InChI=1S/C13H14BrClN2O/c1-2-6-16-12(13-9(14)5-8-18-13)11-10(15)4-3-7-17-11/h3-5,7-8,12,16H,2,6H2,1H3 |
| InChIKey | BKHZNTAGMNEOPW-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 38.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.62 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |