C14H14Br2ClNO — CID 115861234
N-[(4-bromo-2-chlorophenyl)-(3-bromofuran-2-yl)methyl]propan-1-amine (PubChem CID 115861234) has the molecular formula C14H14Br2ClNO and a molecular weight of 407.53 g/mol. Its IUPAC name is N-[(4-bromo-2-chlorophenyl)-(3-bromofuran-2-yl)methyl]propan-1-amine.
| Compound Name | N-[(4-bromo-2-chlorophenyl)-(3-bromofuran-2-yl)methyl]propan-1-amine |
|---|---|
| PubChem CID | 115861234 |
| Molecular Formula | C14H14Br2ClNO |
| Molecular Weight | 407.53 g/mol |
| Exact Mass | 404.91 |
| IUPAC Name | N-[(4-bromo-2-chlorophenyl)-(3-bromofuran-2-yl)methyl]propan-1-amine |
| SMILES | CCCNC(c1ccc(Br)cc1Cl)c1occc1Br |
| InChI | InChI=1S/C14H14Br2ClNO/c1-2-6-18-13(14-11(16)5-7-19-14)10-4-3-9(15)8-12(10)17/h3-5,7-8,13,18H,2,6H2,1H3 |
| InChIKey | LLYDFKAQDWHCSF-UHFFFAOYSA-N |
| XLogP | 5.55 |
| TPSA | 25.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.53 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |