C15H14F2N2O2 — CID 107358477
2-fluoro-N-[1-(3-fluoro-4-methoxyphenyl)ethyl]pyridine-3-carboxamide (PubChem CID 107358477) has the molecular formula C15H14F2N2O2 and a molecular weight of 292.29 g/mol. Its IUPAC name is 2-fluoro-N-[1-(3-fluoro-4-methoxyphenyl)ethyl]pyridine-3-carboxamide.
| Compound Name | 2-fluoro-N-[1-(3-fluoro-4-methoxyphenyl)ethyl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 107358477 |
| Molecular Formula | C15H14F2N2O2 |
| Molecular Weight | 292.29 g/mol |
| Exact Mass | 292.10 |
| IUPAC Name | 2-fluoro-N-[1-(3-fluoro-4-methoxyphenyl)ethyl]pyridine-3-carboxamide |
| SMILES | COc1ccc(C(C)NC(=O)c2cccnc2F)cc1F |
| InChI | InChI=1S/C15H14F2N2O2/c1-9(10-5-6-13(21-2)12(16)8-10)19-15(20)11-4-3-7-18-14(11)17/h3-9H,1-2H3,(H,19,20) |
| InChIKey | ACKQIAGVFWXUFR-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.29 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|