C19H33NO4 — CID 10735851
tert-butyl 2-[(Z)-1-ethoxy-1-oxohept-2-en-3-yl]piperidine-1-carboxylate (PubChem CID 10735851) has the molecular formula C19H33NO4 and a molecular weight of 339.48 g/mol. Its IUPAC name is tert-butyl 2-[(Z)-1-ethoxy-1-oxohept-2-en-3-yl]piperidine-1-carboxylate.
| Compound Name | tert-butyl 2-[(Z)-1-ethoxy-1-oxohept-2-en-3-yl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 10735851 |
| Molecular Formula | C19H33NO4 |
| Molecular Weight | 339.48 g/mol |
| Exact Mass | 339.24 |
| IUPAC Name | tert-butyl 2-[(Z)-1-ethoxy-1-oxohept-2-en-3-yl]piperidine-1-carboxylate |
| SMILES | CCCC/C(=C/C(=O)OCC)C1CCCCN1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C19H33NO4/c1-6-8-11-15(14-17(21)23-7-2)16-12-9-10-13-20(16)18(22)24-19(3,4)5/h14,16H,6-13H2,1-5H3/b15-14- |
| InChIKey | CEDJOVMWTFNJFJ-PFONDFGASA-N |
| XLogP | 4.46 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.48 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|