C9H12ClNO3S2 — CID 107361370
2-amino-1-(3-chlorothiophen-2-yl)-4-methylsulfonylbutan-1-one (PubChem CID 107361370) has the molecular formula C9H12ClNO3S2 and a molecular weight of 281.79 g/mol. Its IUPAC name is 2-amino-1-(3-chlorothiophen-2-yl)-4-methylsulfonylbutan-1-one.
| Compound Name | 2-amino-1-(3-chlorothiophen-2-yl)-4-methylsulfonylbutan-1-one |
|---|---|
| PubChem CID | 107361370 |
| Molecular Formula | C9H12ClNO3S2 |
| Molecular Weight | 281.79 g/mol |
| Exact Mass | 280.99 |
| IUPAC Name | 2-amino-1-(3-chlorothiophen-2-yl)-4-methylsulfonylbutan-1-one |
| SMILES | CS(=O)(=O)CCC(N)C(=O)c1sccc1Cl |
| InChI | InChI=1S/C9H12ClNO3S2/c1-16(13,14)5-3-7(11)8(12)9-6(10)2-4-15-9/h2,4,7H,3,5,11H2,1H3 |
| InChIKey | HZGZFUPRABKDPR-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 77.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.79 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |