C12H20ClN3OS — CID 107362112
[(3-chlorothiophen-2-yl)-(4-propan-2-ylmorpholin-2-yl)methyl]hydrazine (PubChem CID 107362112) has the molecular formula C12H20ClN3OS and a molecular weight of 289.83 g/mol. Its IUPAC name is [(3-chlorothiophen-2-yl)-(4-propan-2-ylmorpholin-2-yl)methyl]hydrazine.
| Compound Name | [(3-chlorothiophen-2-yl)-(4-propan-2-ylmorpholin-2-yl)methyl]hydrazine |
|---|---|
| PubChem CID | 107362112 |
| Molecular Formula | C12H20ClN3OS |
| Molecular Weight | 289.83 g/mol |
| Exact Mass | 289.10 |
| IUPAC Name | [(3-chlorothiophen-2-yl)-(4-propan-2-ylmorpholin-2-yl)methyl]hydrazine |
| SMILES | CC(C)N1CCOC(C(NN)c2sccc2Cl)C1 |
| InChI | InChI=1S/C12H20ClN3OS/c1-8(2)16-4-5-17-10(7-16)11(15-14)12-9(13)3-6-18-12/h3,6,8,10-11,15H,4-5,7,14H2,1-2H3 |
| InChIKey | ZCKPULQNUFBSRH-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 50.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.83 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|