C8H15NO2S — CID 107363205
N-(4-hydroxy-3-methylsulfanylbutan-2-yl)prop-2-enamide (PubChem CID 107363205) has the molecular formula C8H15NO2S and a molecular weight of 189.28 g/mol. Its IUPAC name is N-(4-hydroxy-3-methylsulfanylbutan-2-yl)prop-2-enamide.
| Compound Name | N-(4-hydroxy-3-methylsulfanylbutan-2-yl)prop-2-enamide |
|---|---|
| PubChem CID | 107363205 |
| Molecular Formula | C8H15NO2S |
| Molecular Weight | 189.28 g/mol |
| Exact Mass | 189.08 |
| IUPAC Name | N-(4-hydroxy-3-methylsulfanylbutan-2-yl)prop-2-enamide |
| SMILES | C=CC(=O)NC(C)C(CO)SC |
| InChI | InChI=1S/C8H15NO2S/c1-4-8(11)9-6(2)7(5-10)12-3/h4,6-7,10H,1,5H2,2-3H3,(H,9,11) |
| InChIKey | DQWSTOWHTLGNNL-UHFFFAOYSA-N |
| XLogP | 0.40 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 189.28 |
| LogP ≤ 5 | 0.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|