C11H14ClFN2 — CID 107364181
3-N-(3-chloro-5-fluorophenyl)cyclopentane-1,3-diamine (PubChem CID 107364181) has the molecular formula C11H14ClFN2 and a molecular weight of 228.70 g/mol. Its IUPAC name is 3-N-(3-chloro-5-fluorophenyl)cyclopentane-1,3-diamine.
| Compound Name | 3-N-(3-chloro-5-fluorophenyl)cyclopentane-1,3-diamine |
|---|---|
| PubChem CID | 107364181 |
| Molecular Formula | C11H14ClFN2 |
| Molecular Weight | 228.70 g/mol |
| Exact Mass | 228.08 |
| IUPAC Name | 3-N-(3-chloro-5-fluorophenyl)cyclopentane-1,3-diamine |
| SMILES | NC1CCC(Nc2cc(F)cc(Cl)c2)C1 |
| InChI | InChI=1S/C11H14ClFN2/c12-7-3-8(13)5-11(4-7)15-10-2-1-9(14)6-10/h3-5,9-10,15H,1-2,6,14H2 |
| InChIKey | PAPLAGQCCLBUDN-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.70 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |