C11H15FN2 — CID 80562430
1-N-(3-fluoro-5-methylphenyl)cyclobutane-1,3-diamine (PubChem CID 80562430) has the molecular formula C11H15FN2 and a molecular weight of 194.25 g/mol. Its IUPAC name is 1-N-(3-fluoro-5-methylphenyl)cyclobutane-1,3-diamine.
| Compound Name | 1-N-(3-fluoro-5-methylphenyl)cyclobutane-1,3-diamine |
|---|---|
| PubChem CID | 80562430 |
| Molecular Formula | C11H15FN2 |
| Molecular Weight | 194.25 g/mol |
| Exact Mass | 194.12 |
| IUPAC Name | 1-N-(3-fluoro-5-methylphenyl)cyclobutane-1,3-diamine |
| SMILES | Cc1cc(F)cc(NC2CC(N)C2)c1 |
| InChI | InChI=1S/C11H15FN2/c1-7-2-8(12)4-10(3-7)14-11-5-9(13)6-11/h2-4,9,11,14H,5-6,13H2,1H3 |
| InChIKey | CGGUWFPTOWJBJX-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.25 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |