C14H11ClF4N2 — CID 107364470
N-(3-chloro-5-fluorophenyl)-1-(3,4,5-trifluorophenyl)ethane-1,2-diamine (PubChem CID 107364470) has the molecular formula C14H11ClF4N2 and a molecular weight of 318.70 g/mol. Its IUPAC name is N-(3-chloro-5-fluorophenyl)-1-(3,4,5-trifluorophenyl)ethane-1,2-diamine.
| Compound Name | N-(3-chloro-5-fluorophenyl)-1-(3,4,5-trifluorophenyl)ethane-1,2-diamine |
|---|---|
| PubChem CID | 107364470 |
| Molecular Formula | C14H11ClF4N2 |
| Molecular Weight | 318.70 g/mol |
| Exact Mass | 318.05 |
| IUPAC Name | N-(3-chloro-5-fluorophenyl)-1-(3,4,5-trifluorophenyl)ethane-1,2-diamine |
| SMILES | NCC(Nc1cc(F)cc(Cl)c1)c1cc(F)c(F)c(F)c1 |
| InChI | InChI=1S/C14H11ClF4N2/c15-8-3-9(16)5-10(4-8)21-13(6-20)7-1-11(17)14(19)12(18)2-7/h1-5,13,21H,6,20H2 |
| InChIKey | SOVZVUBECSMFBD-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.70 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|