C13H14OS2 — CID 107365237
[5-(2,5-dimethylphenyl)sulfanylthiophen-2-yl]methanol (PubChem CID 107365237) has the molecular formula C13H14OS2 and a molecular weight of 250.39 g/mol. Its IUPAC name is [5-(2,5-dimethylphenyl)sulfanylthiophen-2-yl]methanol.
| Compound Name | [5-(2,5-dimethylphenyl)sulfanylthiophen-2-yl]methanol |
|---|---|
| PubChem CID | 107365237 |
| Molecular Formula | C13H14OS2 |
| Molecular Weight | 250.39 g/mol |
| Exact Mass | 250.05 |
| IUPAC Name | [5-(2,5-dimethylphenyl)sulfanylthiophen-2-yl]methanol |
| SMILES | Cc1ccc(C)c(Sc2ccc(CO)s2)c1 |
| InChI | InChI=1S/C13H14OS2/c1-9-3-4-10(2)12(7-9)16-13-6-5-11(8-14)15-13/h3-7,14H,8H2,1-2H3 |
| InChIKey | IUZISQSKVBXMKK-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.39 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |