C13H19ClN2O5S — CID 10736621
methyl 1-(4-methoxyphenyl)sulfonylpiperazin-4-ium-2-carboxylate chloride (PubChem CID 10736621) has the molecular formula C13H19ClN2O5S and a molecular weight of 350.82 g/mol. Its IUPAC name is methyl 1-(4-methoxyphenyl)sulfonylpiperazin-4-ium-2-carboxylate chloride.
| Compound Name | methyl 1-(4-methoxyphenyl)sulfonylpiperazin-4-ium-2-carboxylate chloride |
|---|---|
| PubChem CID | 10736621 |
| Molecular Formula | C13H19ClN2O5S |
| Molecular Weight | 350.82 g/mol |
| Exact Mass | 350.07 |
| IUPAC Name | methyl 1-(4-methoxyphenyl)sulfonylpiperazin-4-ium-2-carboxylate chloride |
| SMILES | COC(=O)C1C[NH2+]CCN1S(=O)(=O)c1ccc(OC)cc1.[Cl-] |
| InChI | InChI=1S/C13H18N2O5S.ClH/c1-19-10-3-5-11(6-4-10)21(17,18)15-8-7-14-9-12(15)13(16)20-2;/h3-6,12,14H,7-9H2,1-2H3;1H |
| InChIKey | QJUXCZUCSXFZMY-UHFFFAOYSA-N |
| XLogP | -4.19 |
| TPSA | 89.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.82 |
| LogP ≤ 5 | -4.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |