C15H17N5 — CID 107368193
5-[3-aminopropyl(benzyl)amino]pyrazine-2-carbonitrile (PubChem CID 107368193) has the molecular formula C15H17N5 and a molecular weight of 267.34 g/mol. Its IUPAC name is 5-[3-aminopropyl(benzyl)amino]pyrazine-2-carbonitrile.
| Compound Name | 5-[3-aminopropyl(benzyl)amino]pyrazine-2-carbonitrile |
|---|---|
| PubChem CID | 107368193 |
| Molecular Formula | C15H17N5 |
| Molecular Weight | 267.34 g/mol |
| Exact Mass | 267.15 |
| IUPAC Name | 5-[3-aminopropyl(benzyl)amino]pyrazine-2-carbonitrile |
| SMILES | N#Cc1cnc(N(CCCN)Cc2ccccc2)cn1 |
| InChI | InChI=1S/C15H17N5/c16-7-4-8-20(12-13-5-2-1-3-6-13)15-11-18-14(9-17)10-19-15/h1-3,5-6,10-11H,4,7-8,12,16H2 |
| InChIKey | PWGAVRUMNNVAPH-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 78.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.34 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |