C16H19ClN2 — CID 28770789
N'-benzyl-N'-(2-chlorophenyl)propane-1,3-diamine (PubChem CID 28770789) has the molecular formula C16H19ClN2 and a molecular weight of 274.80 g/mol. Its IUPAC name is N'-benzyl-N'-(2-chlorophenyl)propane-1,3-diamine.
| Compound Name | N'-benzyl-N'-(2-chlorophenyl)propane-1,3-diamine |
|---|---|
| PubChem CID | 28770789 |
| Molecular Formula | C16H19ClN2 |
| Molecular Weight | 274.80 g/mol |
| Exact Mass | 274.12 |
| IUPAC Name | N'-benzyl-N'-(2-chlorophenyl)propane-1,3-diamine |
| SMILES | NCCCN(Cc1ccccc1)c1ccccc1Cl |
| InChI | InChI=1S/C16H19ClN2/c17-15-9-4-5-10-16(15)19(12-6-11-18)13-14-7-2-1-3-8-14/h1-5,7-10H,6,11-13,18H2 |
| InChIKey | BEQUESLICJCYIK-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.80 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |