C21H22ClNO2 — CID 10736952
(Z)-1-(1-benzylpiperidin-3-yl)-3-(4-chlorophenyl)-3-hydroxyprop-2-en-1-one (PubChem CID 10736952) has the molecular formula C21H22ClNO2 and a molecular weight of 355.87 g/mol. Its IUPAC name is (Z)-1-(1-benzylpiperidin-3-yl)-3-(4-chlorophenyl)-3-hydroxyprop-2-en-1-one.
| Compound Name | (Z)-1-(1-benzylpiperidin-3-yl)-3-(4-chlorophenyl)-3-hydroxyprop-2-en-1-one |
|---|---|
| PubChem CID | 10736952 |
| Molecular Formula | C21H22ClNO2 |
| Molecular Weight | 355.87 g/mol |
| Exact Mass | 355.13 |
| IUPAC Name | (Z)-1-(1-benzylpiperidin-3-yl)-3-(4-chlorophenyl)-3-hydroxyprop-2-en-1-one |
| SMILES | O=C(/C=C(\O)c1ccc(Cl)cc1)C1CCCN(Cc2ccccc2)C1 |
| InChI | InChI=1S/C21H22ClNO2/c22-19-10-8-17(9-11-19)20(24)13-21(25)18-7-4-12-23(15-18)14-16-5-2-1-3-6-16/h1-3,5-6,8-11,13,18,24H,4,7,12,14-15H2/b20-13- |
| InChIKey | NEEOJCVMKXJTSZ-MOSHPQCFSA-N |
| XLogP | 4.72 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.87 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|