3-[(1-ethylcyclobutyl)carbamoyl]-1,2-oxazole-5-carboxylic acid

C11H14N2O4 — CID 107369989

IUPAC3-[(1-ethylcyclobutyl)carbamoyl]-1,2-oxazole-5-carboxylic acid
SMILESCCC1(NC(=O)c2cc(C(=O)O)on2)CCC1
InChIInChI=1S/C11H14N2O4/c1-2-11(4-3-5-11)12-9(14)7-6-8(10(15)16)17-13-7/h6H,2-5H2,1H3,(H,12,14)(H,15,16)
InChIKeyHXGOWMBEWMPXHX-UHFFFAOYSA-N
MW238.24 g/mol
LogP1.44
Rot. Bonds4

About 3-[(1-ethylcyclobutyl)carbamoyl]-1,2-oxazole-5-carboxylic acid

3-[(1-ethylcyclobutyl)carbamoyl]-1,2-oxazole-5-carboxylic acid (PubChem CID 107369989) has the molecular formula C11H14N2O4 and a molecular weight of 238.24 g/mol. Its IUPAC name is 3-[(1-ethylcyclobutyl)carbamoyl]-1,2-oxazole-5-carboxylic acid.

Molecular Properties

Compound Name3-[(1-ethylcyclobutyl)carbamoyl]-1,2-oxazole-5-carboxylic acid
PubChem CID107369989
Molecular FormulaC11H14N2O4
Molecular Weight238.24 g/mol
Exact Mass238.10
IUPAC Name3-[(1-ethylcyclobutyl)carbamoyl]-1,2-oxazole-5-carboxylic acid
SMILESCCC1(NC(=O)c2cc(C(=O)O)on2)CCC1
InChIInChI=1S/C11H14N2O4/c1-2-11(4-3-5-11)12-9(14)7-6-8(10(15)16)17-13-7/h6H,2-5H2,1H3,(H,12,14)(H,15,16)
InChIKeyHXGOWMBEWMPXHX-UHFFFAOYSA-N
XLogP1.44
TPSA92.43 Ų
H-Bond Donors2
H-Bond Acceptors4
Rotatable Bonds4
Heavy Atoms17
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500238.24
LogP ≤ 51.44
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 104

Analyze 3-[(1-ethylcyclobutyl)carbamoyl]-1,2-oxazole-5-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3-[(1-ethylcyclobutyl)carbamoyl]-1,2-oxazole-5-carboxylic acid?
The IUPAC name of 3-[(1-ethylcyclobutyl)carbamoyl]-1,2-oxazole-5-carboxylic acid (CID 107369989) is 3-[(1-ethylcyclobutyl)carbamoyl]-1,2-oxazole-5-carboxylic acid.
What is the SMILES notation for 3-[(1-ethylcyclobutyl)carbamoyl]-1,2-oxazole-5-carboxylic acid?
The canonical SMILES for 3-[(1-ethylcyclobutyl)carbamoyl]-1,2-oxazole-5-carboxylic acid is CCC1(NC(=O)c2cc(C(=O)O)on2)CCC1.
What is the InChIKey of 3-[(1-ethylcyclobutyl)carbamoyl]-1,2-oxazole-5-carboxylic acid?
The InChIKey is HXGOWMBEWMPXHX-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H14N2O4/c1-2-11(4-3-5-11)12-9(14)7-6-8(10(15)16)17-13-7/h6H,2-5H2,1H3,(H,12,14)(H,15,16).
What are the key properties of 3-[(1-ethylcyclobutyl)carbamoyl]-1,2-oxazole-5-carboxylic acid?
3-[(1-ethylcyclobutyl)carbamoyl]-1,2-oxazole-5-carboxylic acid has a molecular weight of 238.24 g/mol, XLogP of 1.44, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(1-ethylcyclobutyl)carbamoyl]-1,2-oxazole-5-carboxylic acid is sourced from PubChem (CID 107369989), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).