C22H28O2S — CID 10737002
3-(2-methylpropoxy)-6-[(3E)-4-phenylsulfanylhexa-3,5-dienyl]cyclohex-2-en-1-one (PubChem CID 10737002) has the molecular formula C22H28O2S and a molecular weight of 356.53 g/mol. Its IUPAC name is 3-(2-methylpropoxy)-6-[(3E)-4-phenylsulfanylhexa-3,5-dienyl]cyclohex-2-en-1-one.
| Compound Name | 3-(2-methylpropoxy)-6-[(3E)-4-phenylsulfanylhexa-3,5-dienyl]cyclohex-2-en-1-one |
|---|---|
| PubChem CID | 10737002 |
| Molecular Formula | C22H28O2S |
| Molecular Weight | 356.53 g/mol |
| Exact Mass | 356.18 |
| IUPAC Name | 3-(2-methylpropoxy)-6-[(3E)-4-phenylsulfanylhexa-3,5-dienyl]cyclohex-2-en-1-one |
| SMILES | C=C/C(=C\CCC1CCC(OCC(C)C)=CC1=O)Sc1ccccc1 |
| InChI | InChI=1S/C22H28O2S/c1-4-20(25-21-10-6-5-7-11-21)12-8-9-18-13-14-19(15-22(18)23)24-16-17(2)3/h4-7,10-12,15,17-18H,1,8-9,13-14,16H2,2-3H3/b20-12+ |
| InChIKey | PSNHWARWAXVLLS-UDWIEESQSA-N |
| XLogP | 6.16 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.53 |
| LogP ≤ 5 | 6.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|