C12H10ClFN4O — CID 107370610
N-(3-chloro-5-fluorophenyl)-2-hydrazinylpyridine-4-carboxamide (PubChem CID 107370610) has the molecular formula C12H10ClFN4O and a molecular weight of 280.69 g/mol. Its IUPAC name is N-(3-chloro-5-fluorophenyl)-2-hydrazinylpyridine-4-carboxamide.
| Compound Name | N-(3-chloro-5-fluorophenyl)-2-hydrazinylpyridine-4-carboxamide |
|---|---|
| PubChem CID | 107370610 |
| Molecular Formula | C12H10ClFN4O |
| Molecular Weight | 280.69 g/mol |
| Exact Mass | 280.05 |
| IUPAC Name | N-(3-chloro-5-fluorophenyl)-2-hydrazinylpyridine-4-carboxamide |
| SMILES | NNc1cc(C(=O)Nc2cc(F)cc(Cl)c2)ccn1 |
| InChI | InChI=1S/C12H10ClFN4O/c13-8-4-9(14)6-10(5-8)17-12(19)7-1-2-16-11(3-7)18-15/h1-6H,15H2,(H,16,18)(H,17,19) |
| InChIKey | DDGVCPUHWOKHQA-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 80.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.69 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|