C10H12ClN3O3 — CID 107371495
2-[(5-chloropyrazine-2-carbonyl)-methylamino]butanoic acid (PubChem CID 107371495) has the molecular formula C10H12ClN3O3 and a molecular weight of 257.68 g/mol. Its IUPAC name is 2-[(5-chloropyrazine-2-carbonyl)-methylamino]butanoic acid.
| Compound Name | 2-[(5-chloropyrazine-2-carbonyl)-methylamino]butanoic acid |
|---|---|
| PubChem CID | 107371495 |
| Molecular Formula | C10H12ClN3O3 |
| Molecular Weight | 257.68 g/mol |
| Exact Mass | 257.06 |
| IUPAC Name | 2-[(5-chloropyrazine-2-carbonyl)-methylamino]butanoic acid |
| SMILES | CCC(C(=O)O)N(C)C(=O)c1cnc(Cl)cn1 |
| InChI | InChI=1S/C10H12ClN3O3/c1-3-7(10(16)17)14(2)9(15)6-4-13-8(11)5-12-6/h4-5,7H,3H2,1-2H3,(H,16,17) |
| InChIKey | VVHPPXQUVZDTMH-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 83.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.68 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |