C11H19N3OS — CID 107372975
[5-[methyl(4-methylsulfanylbutan-2-yl)amino]pyrazin-2-yl]methanol (PubChem CID 107372975) has the molecular formula C11H19N3OS and a molecular weight of 241.36 g/mol. Its IUPAC name is [5-[methyl(4-methylsulfanylbutan-2-yl)amino]pyrazin-2-yl]methanol.
| Compound Name | [5-[methyl(4-methylsulfanylbutan-2-yl)amino]pyrazin-2-yl]methanol |
|---|---|
| PubChem CID | 107372975 |
| Molecular Formula | C11H19N3OS |
| Molecular Weight | 241.36 g/mol |
| Exact Mass | 241.12 |
| IUPAC Name | [5-[methyl(4-methylsulfanylbutan-2-yl)amino]pyrazin-2-yl]methanol |
| SMILES | CSCCC(C)N(C)c1cnc(CO)cn1 |
| InChI | InChI=1S/C11H19N3OS/c1-9(4-5-16-3)14(2)11-7-12-10(8-15)6-13-11/h6-7,9,15H,4-5,8H2,1-3H3 |
| InChIKey | XBLWXASLSUULJV-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 49.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.36 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |