C12H22N4S — CID 107380932
N-methyl-5-(methylaminomethyl)-N-(4-methylsulfanylbutan-2-yl)pyrazin-2-amine (PubChem CID 107380932) has the molecular formula C12H22N4S and a molecular weight of 254.40 g/mol. Its IUPAC name is N-methyl-5-(methylaminomethyl)-N-(4-methylsulfanylbutan-2-yl)pyrazin-2-amine.
| Compound Name | N-methyl-5-(methylaminomethyl)-N-(4-methylsulfanylbutan-2-yl)pyrazin-2-amine |
|---|---|
| PubChem CID | 107380932 |
| Molecular Formula | C12H22N4S |
| Molecular Weight | 254.40 g/mol |
| Exact Mass | 254.16 |
| IUPAC Name | N-methyl-5-(methylaminomethyl)-N-(4-methylsulfanylbutan-2-yl)pyrazin-2-amine |
| SMILES | CNCc1cnc(N(C)C(C)CCSC)cn1 |
| InChI | InChI=1S/C12H22N4S/c1-10(5-6-17-4)16(3)12-9-14-11(7-13-2)8-15-12/h8-10,13H,5-7H2,1-4H3 |
| InChIKey | YZYCMCDCOBZEHY-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 41.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.40 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |