C8H8F4N2O2 — CID 107373147
[5-(2,2,3,3-tetrafluoropropoxy)pyrazin-2-yl]methanol (PubChem CID 107373147) has the molecular formula C8H8F4N2O2 and a molecular weight of 240.16 g/mol. Its IUPAC name is [5-(2,2,3,3-tetrafluoropropoxy)pyrazin-2-yl]methanol.
| Compound Name | [5-(2,2,3,3-tetrafluoropropoxy)pyrazin-2-yl]methanol |
|---|---|
| PubChem CID | 107373147 |
| Molecular Formula | C8H8F4N2O2 |
| Molecular Weight | 240.16 g/mol |
| Exact Mass | 240.05 |
| IUPAC Name | [5-(2,2,3,3-tetrafluoropropoxy)pyrazin-2-yl]methanol |
| SMILES | OCc1cnc(OCC(F)(F)C(F)F)cn1 |
| InChI | InChI=1S/C8H8F4N2O2/c9-7(10)8(11,12)4-16-6-2-13-5(3-15)1-14-6/h1-2,7,15H,3-4H2 |
| InChIKey | XMQAPTFVWIGWAP-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 55.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.16 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|