C14H17N5O — CID 107374502
5-(ethylamino)-N-(1-pyridin-2-ylethyl)pyrazine-2-carboxamide (PubChem CID 107374502) has the molecular formula C14H17N5O and a molecular weight of 271.32 g/mol. Its IUPAC name is 5-(ethylamino)-N-(1-pyridin-2-ylethyl)pyrazine-2-carboxamide.
| Compound Name | 5-(ethylamino)-N-(1-pyridin-2-ylethyl)pyrazine-2-carboxamide |
|---|---|
| PubChem CID | 107374502 |
| Molecular Formula | C14H17N5O |
| Molecular Weight | 271.32 g/mol |
| Exact Mass | 271.14 |
| IUPAC Name | 5-(ethylamino)-N-(1-pyridin-2-ylethyl)pyrazine-2-carboxamide |
| SMILES | CCNc1cnc(C(=O)NC(C)c2ccccn2)cn1 |
| InChI | InChI=1S/C14H17N5O/c1-3-15-13-9-17-12(8-18-13)14(20)19-10(2)11-6-4-5-7-16-11/h4-10H,3H2,1-2H3,(H,15,18)(H,19,20) |
| InChIKey | LSRQQFQZEUKLSM-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 79.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.32 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |