C13H15N5O — CID 107375550
5-(methylamino)-N-[(6-methyl-3-pyridinyl)methyl]pyrazine-2-carboxamide (PubChem CID 107375550) has the molecular formula C13H15N5O and a molecular weight of 257.30 g/mol. Its IUPAC name is 5-(methylamino)-N-[(6-methyl-3-pyridinyl)methyl]pyrazine-2-carboxamide.
| Compound Name | 5-(methylamino)-N-[(6-methyl-3-pyridinyl)methyl]pyrazine-2-carboxamide |
|---|---|
| PubChem CID | 107375550 |
| Molecular Formula | C13H15N5O |
| Molecular Weight | 257.30 g/mol |
| Exact Mass | 257.13 |
| IUPAC Name | 5-(methylamino)-N-[(6-methyl-3-pyridinyl)methyl]pyrazine-2-carboxamide |
| SMILES | CNc1cnc(C(=O)NCc2ccc(C)nc2)cn1 |
| InChI | InChI=1S/C13H15N5O/c1-9-3-4-10(5-15-9)6-18-13(19)11-7-17-12(14-2)8-16-11/h3-5,7-8H,6H2,1-2H3,(H,14,17)(H,18,19) |
| InChIKey | XXQXVMQGLXGWCS-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 79.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.30 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |