C10H15N5O2 — CID 107374531
N-(2-acetamidoethyl)-5-(methylamino)pyrazine-2-carboxamide (PubChem CID 107374531) has the molecular formula C10H15N5O2 and a molecular weight of 237.26 g/mol. Its IUPAC name is N-(2-acetamidoethyl)-5-(methylamino)pyrazine-2-carboxamide.
| Compound Name | N-(2-acetamidoethyl)-5-(methylamino)pyrazine-2-carboxamide |
|---|---|
| PubChem CID | 107374531 |
| Molecular Formula | C10H15N5O2 |
| Molecular Weight | 237.26 g/mol |
| Exact Mass | 237.12 |
| IUPAC Name | N-(2-acetamidoethyl)-5-(methylamino)pyrazine-2-carboxamide |
| SMILES | CNc1cnc(C(=O)NCCNC(C)=O)cn1 |
| InChI | InChI=1S/C10H15N5O2/c1-7(16)12-3-4-13-10(17)8-5-15-9(11-2)6-14-8/h5-6H,3-4H2,1-2H3,(H,11,15)(H,12,16)(H,13,17) |
| InChIKey | DPSIAUZBEZOYHM-UHFFFAOYSA-N |
| XLogP | -0.62 |
| TPSA | 96.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.26 |
| LogP ≤ 5 | -0.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|