C13H18N6O — CID 107374698
5-(methylamino)-N-[3-(5-methyl-1H-pyrazol-4-yl)propyl]pyrazine-2-carboxamide (PubChem CID 107374698) has the molecular formula C13H18N6O and a molecular weight of 274.33 g/mol. Its IUPAC name is 5-(methylamino)-N-[3-(5-methyl-1H-pyrazol-4-yl)propyl]pyrazine-2-carboxamide.
| Compound Name | 5-(methylamino)-N-[3-(5-methyl-1H-pyrazol-4-yl)propyl]pyrazine-2-carboxamide |
|---|---|
| PubChem CID | 107374698 |
| Molecular Formula | C13H18N6O |
| Molecular Weight | 274.33 g/mol |
| Exact Mass | 274.15 |
| IUPAC Name | 5-(methylamino)-N-[3-(5-methyl-1H-pyrazol-4-yl)propyl]pyrazine-2-carboxamide |
| SMILES | CNc1cnc(C(=O)NCCCc2cn[nH]c2C)cn1 |
| InChI | InChI=1S/C13H18N6O/c1-9-10(6-18-19-9)4-3-5-15-13(20)11-7-17-12(14-2)8-16-11/h6-8H,3-5H2,1-2H3,(H,14,17)(H,15,20)(H,18,19) |
| InChIKey | AJUWYRBUTFRNCD-UHFFFAOYSA-N |
| XLogP | 0.91 |
| TPSA | 95.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.33 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|