C13H15ClN4O — CID 62239437
6-chloro-N-[3-(5-methyl-1H-pyrazol-4-yl)propyl]pyridine-2-carboxamide (PubChem CID 62239437) has the molecular formula C13H15ClN4O and a molecular weight of 278.74 g/mol. Its IUPAC name is 6-chloro-N-[3-(5-methyl-1H-pyrazol-4-yl)propyl]pyridine-2-carboxamide.
| Compound Name | 6-chloro-N-[3-(5-methyl-1H-pyrazol-4-yl)propyl]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 62239437 |
| Molecular Formula | C13H15ClN4O |
| Molecular Weight | 278.74 g/mol |
| Exact Mass | 278.09 |
| IUPAC Name | 6-chloro-N-[3-(5-methyl-1H-pyrazol-4-yl)propyl]pyridine-2-carboxamide |
| SMILES | Cc1[nH]ncc1CCCNC(=O)c1cccc(Cl)n1 |
| InChI | InChI=1S/C13H15ClN4O/c1-9-10(8-16-18-9)4-3-7-15-13(19)11-5-2-6-12(14)17-11/h2,5-6,8H,3-4,7H2,1H3,(H,15,19)(H,16,18) |
| InChIKey | CJHLNLDFSABRSZ-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.74 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|