C15H17F2N3O — CID 82800230
2,6-difluoro-3-methyl-N-[3-(5-methyl-1H-pyrazol-4-yl)propyl]benzamide (PubChem CID 82800230) has the molecular formula C15H17F2N3O and a molecular weight of 293.32 g/mol. Its IUPAC name is 2,6-difluoro-3-methyl-N-[3-(5-methyl-1H-pyrazol-4-yl)propyl]benzamide.
| Compound Name | 2,6-difluoro-3-methyl-N-[3-(5-methyl-1H-pyrazol-4-yl)propyl]benzamide |
|---|---|
| PubChem CID | 82800230 |
| Molecular Formula | C15H17F2N3O |
| Molecular Weight | 293.32 g/mol |
| Exact Mass | 293.13 |
| IUPAC Name | 2,6-difluoro-3-methyl-N-[3-(5-methyl-1H-pyrazol-4-yl)propyl]benzamide |
| SMILES | Cc1ccc(F)c(C(=O)NCCCc2cn[nH]c2C)c1F |
| InChI | InChI=1S/C15H17F2N3O/c1-9-5-6-12(16)13(14(9)17)15(21)18-7-3-4-11-8-19-20-10(11)2/h5-6,8H,3-4,7H2,1-2H3,(H,18,21)(H,19,20) |
| InChIKey | VQSGPYBDVROJLG-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 57.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.32 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|